ChemNet > CAS > 141134-24-9 4-(difluoromethoxy)phenacyl bromide
141134-24-9 4-(difluoromethoxy)phenacyl bromide
| product Name |
4-(difluoromethoxy)phenacyl bromide |
| CAS No |
141134-24-9 |
| Synonyms |
2-Bromo-1-[4-(difluoromethoxy)phenyl]ethan-1-one; 2-bromo-1-[4-(difluoromethoxy)phenyl]ethanone |
| Molecular Formula |
C9H7BrF2O2 |
| Molecular Weight |
265.0515 |
| InChI |
InChI=1/C9H7BrF2O2/c10-5-8(13)6-1-3-7(4-2-6)14-9(11)12/h1-4,9H,5H2 |
| Molecular Structure |
|
| Density |
1.564g/cm3 |
| Melting point |
66-68℃ |
| Boiling point |
301.9°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
136.4°C |
| Vapour Pressur |
0.00102mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
